C12H17FO4 — CID 171872620
1-(2-ethoxy-5-fluorophenyl)butane-1,2,4-triol (PubChem CID 171872620) has the molecular formula C12H17FO4 and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-(2-ethoxy-5-fluorophenyl)butane-1,2,4-triol.
| Compound Name | 1-(2-ethoxy-5-fluorophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872620 |
| Molecular Formula | C12H17FO4 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-(2-ethoxy-5-fluorophenyl)butane-1,2,4-triol |
| SMILES | CCOc1ccc(F)cc1C(O)C(O)CCO |
| InChI | InChI=1S/C12H17FO4/c1-2-17-11-4-3-8(13)7-9(11)12(16)10(15)5-6-14/h3-4,7,10,12,14-16H,2,5-6H2,1H3 |
| InChIKey | DDQUUXCKYJYYKJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |