C14H23FN2O2 — CID 83944016
2-amino-4-(dimethylamino)-1-(2-ethoxy-5-fluorophenyl)butan-1-ol (PubChem CID 83944016) has the molecular formula C14H23FN2O2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-amino-4-(dimethylamino)-1-(2-ethoxy-5-fluorophenyl)butan-1-ol.
| Compound Name | 2-amino-4-(dimethylamino)-1-(2-ethoxy-5-fluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 83944016 |
| Molecular Formula | C14H23FN2O2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-amino-4-(dimethylamino)-1-(2-ethoxy-5-fluorophenyl)butan-1-ol |
| SMILES | CCOc1ccc(F)cc1C(O)C(N)CCN(C)C |
| InChI | InChI=1S/C14H23FN2O2/c1-4-19-13-6-5-10(15)9-11(13)14(18)12(16)7-8-17(2)3/h5-6,9,12,14,18H,4,7-8,16H2,1-3H3 |
| InChIKey | IRBOPOPOMUPZEA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |