C13H21FN2O2 — CID 83943899
2-amino-4-(dimethylamino)-1-(5-fluoro-2-methoxyphenyl)butan-1-ol (PubChem CID 83943899) has the molecular formula C13H21FN2O2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-amino-4-(dimethylamino)-1-(5-fluoro-2-methoxyphenyl)butan-1-ol.
| Compound Name | 2-amino-4-(dimethylamino)-1-(5-fluoro-2-methoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 83943899 |
| Molecular Formula | C13H21FN2O2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-amino-4-(dimethylamino)-1-(5-fluoro-2-methoxyphenyl)butan-1-ol |
| SMILES | COc1ccc(F)cc1C(O)C(N)CCN(C)C |
| InChI | InChI=1S/C13H21FN2O2/c1-16(2)7-6-11(15)13(17)10-8-9(14)4-5-12(10)18-3/h4-5,8,11,13,17H,6-7,15H2,1-3H3 |
| InChIKey | UXSROWNVYCIIGZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |