C13H20FNO3 — CID 83944144
2-amino-1-(5-fluoro-2-propoxyphenyl)butane-1,4-diol (PubChem CID 83944144) has the molecular formula C13H20FNO3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-amino-1-(5-fluoro-2-propoxyphenyl)butane-1,4-diol.
| Compound Name | 2-amino-1-(5-fluoro-2-propoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 83944144 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-amino-1-(5-fluoro-2-propoxyphenyl)butane-1,4-diol |
| SMILES | CCCOc1ccc(F)cc1C(O)C(N)CCO |
| InChI | InChI=1S/C13H20FNO3/c1-2-7-18-12-4-3-9(14)8-10(12)13(17)11(15)5-6-16/h3-4,8,11,13,16-17H,2,5-7,15H2,1H3 |
| InChIKey | YOWUPZHWFACDJC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |