C12H16FN3O3 — CID 171879785
4-azido-1-(2-ethoxy-5-fluorophenyl)butane-1,2-diol (PubChem CID 171879785) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is 4-azido-1-(2-ethoxy-5-fluorophenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2-ethoxy-5-fluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879785 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-azido-1-(2-ethoxy-5-fluorophenyl)butane-1,2-diol |
| SMILES | CCOc1ccc(F)cc1C(O)C(O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C12H16FN3O3/c1-2-19-11-4-3-8(13)7-9(11)12(18)10(17)5-6-15-16-14/h3-4,7,10,12,17-18H,2,5-6H2,1H3 |
| InChIKey | CKELDYZRPFLUJC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|