C12H15N3O5 — CID 171880069
4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid (PubChem CID 171880069) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid.
| Compound Name | 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 171880069 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1C(O)C(O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C12H15N3O5/c1-20-10-6-7(12(18)19)2-3-8(10)11(17)9(16)4-5-14-15-13/h2-3,6,9,11,16-17H,4-5H2,1H3,(H,18,19) |
| InChIKey | ICSYZUZHMYKBGV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|