4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid

C12H15N3O5 — CID 171880069

IUPAC4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid
SMILESCOc1cc(C(=O)O)ccc1C(O)C(O)CCN=[N+]=[N-]
InChIInChI=1S/C12H15N3O5/c1-20-10-6-7(12(18)19)2-3-8(10)11(17)9(16)4-5-14-15-13/h2-3,6,9,11,16-17H,4-5H2,1H3,(H,18,19)
InChIKeyICSYZUZHMYKBGV-UHFFFAOYSA-N
MW281.27 g/mol
LogP1.49
Rot. Bonds7

About 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid

4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid (PubChem CID 171880069) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid.

Molecular Properties

Compound Name4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid
PubChem CID171880069
Molecular FormulaC12H15N3O5
Molecular Weight281.27 g/mol
Exact Mass281.10
IUPAC Name4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid
SMILESCOc1cc(C(=O)O)ccc1C(O)C(O)CCN=[N+]=[N-]
InChIInChI=1S/C12H15N3O5/c1-20-10-6-7(12(18)19)2-3-8(10)11(17)9(16)4-5-14-15-13/h2-3,6,9,11,16-17H,4-5H2,1H3,(H,18,19)
InChIKeyICSYZUZHMYKBGV-UHFFFAOYSA-N
XLogP1.49
TPSA135.75 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.27
LogP ≤ 51.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid?
The IUPAC name of 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid (CID 171880069) is 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid.
What is the SMILES notation for 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid?
The canonical SMILES for 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid is COc1cc(C(=O)O)ccc1C(O)C(O)CCN=[N+]=[N-].
What is the InChIKey of 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid?
The InChIKey is ICSYZUZHMYKBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O5/c1-20-10-6-7(12(18)19)2-3-8(10)11(17)9(16)4-5-14-15-13/h2-3,6,9,11,16-17H,4-5H2,1H3,(H,18,19).
What are the key properties of 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid?
4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid has a molecular weight of 281.27 g/mol, XLogP of 1.49, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-azido-1,2-dihydroxybutyl)-3-methoxybenzoic acid is sourced from PubChem (CID 171880069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).