C12H15N3O4 — CID 170826582
1-[3-(3-azido-1,2-dihydroxypropyl)-4-methoxyphenyl]ethanone (PubChem CID 170826582) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-[3-(3-azido-1,2-dihydroxypropyl)-4-methoxyphenyl]ethanone.
| Compound Name | 1-[3-(3-azido-1,2-dihydroxypropyl)-4-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 170826582 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-[3-(3-azido-1,2-dihydroxypropyl)-4-methoxyphenyl]ethanone |
| SMILES | COc1ccc(C(C)=O)cc1C(O)C(O)CN=[N+]=[N-] |
| InChI | InChI=1S/C12H15N3O4/c1-7(16)8-3-4-11(19-2)9(5-8)12(18)10(17)6-14-15-13/h3-5,10,12,17-18H,6H2,1-2H3 |
| InChIKey | STXIJYQHDJSQOO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|