C10H12N4O3 — CID 170826144
1-[6-(3-azido-1,2-dihydroxypropyl)-3-pyridinyl]ethanone (PubChem CID 170826144) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-[6-(3-azido-1,2-dihydroxypropyl)-3-pyridinyl]ethanone.
| Compound Name | 1-[6-(3-azido-1,2-dihydroxypropyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 170826144 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-[6-(3-azido-1,2-dihydroxypropyl)-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(C(O)C(O)CN=[N+]=[N-])nc1 |
| InChI | InChI=1S/C10H12N4O3/c1-6(15)7-2-3-8(12-4-7)10(17)9(16)5-13-14-11/h2-4,9-10,16-17H,5H2,1H3 |
| InChIKey | MZTFCYBSWXFRJN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|