C7H9N5O3 — CID 170825484
3-azido-1-(5-hydroxypyrimidin-2-yl)propane-1,2-diol (PubChem CID 170825484) has the molecular formula C7H9N5O3 and a molecular weight of 211.18 g/mol. Its IUPAC name is 3-azido-1-(5-hydroxypyrimidin-2-yl)propane-1,2-diol.
| Compound Name | 3-azido-1-(5-hydroxypyrimidin-2-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170825484 |
| Molecular Formula | C7H9N5O3 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 3-azido-1-(5-hydroxypyrimidin-2-yl)propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ncc(O)cn1 |
| InChI | InChI=1S/C7H9N5O3/c8-12-11-3-5(14)6(15)7-9-1-4(13)2-10-7/h1-2,5-6,13-15H,3H2 |
| InChIKey | ALUMPVCDNDAEIZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|