C9H9N5O2 — CID 170825675
5-(3-azido-1,2-dihydroxypropyl)pyridine-2-carbonitrile (PubChem CID 170825675) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 5-(3-azido-1,2-dihydroxypropyl)pyridine-2-carbonitrile.
| Compound Name | 5-(3-azido-1,2-dihydroxypropyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 170825675 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-(3-azido-1,2-dihydroxypropyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(C(O)C(O)CN=[N+]=[N-])cn1 |
| InChI | InChI=1S/C9H9N5O2/c10-3-7-2-1-6(4-12-7)9(16)8(15)5-13-14-11/h1-2,4,8-9,15-16H,5H2 |
| InChIKey | CIWBVYSQHXJTSB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|