C10H9ClN4O2 — CID 170826051
3-(3-azido-1,2-dihydroxypropyl)-5-chlorobenzonitrile (PubChem CID 170826051) has the molecular formula C10H9ClN4O2 and a molecular weight of 252.66 g/mol. Its IUPAC name is 3-(3-azido-1,2-dihydroxypropyl)-5-chlorobenzonitrile.
| Compound Name | 3-(3-azido-1,2-dihydroxypropyl)-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 170826051 |
| Molecular Formula | C10H9ClN4O2 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-(3-azido-1,2-dihydroxypropyl)-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(C(O)C(O)CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C10H9ClN4O2/c11-8-2-6(4-12)1-7(3-8)10(17)9(16)5-14-15-13/h1-3,9-10,16-17H,5H2 |
| InChIKey | DTTDEWZBZRAMPR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|