C9H8ClF2N3O2 — CID 170827235
3-azido-1-(4-chloro-2,6-difluorophenyl)propane-1,2-diol (PubChem CID 170827235) has the molecular formula C9H8ClF2N3O2 and a molecular weight of 263.63 g/mol. Its IUPAC name is 3-azido-1-(4-chloro-2,6-difluorophenyl)propane-1,2-diol.
| Compound Name | 3-azido-1-(4-chloro-2,6-difluorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827235 |
| Molecular Formula | C9H8ClF2N3O2 |
| Molecular Weight | 263.63 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 3-azido-1-(4-chloro-2,6-difluorophenyl)propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C9H8ClF2N3O2/c10-4-1-5(11)8(6(12)2-4)9(17)7(16)3-14-15-13/h1-2,7,9,16-17H,3H2 |
| InChIKey | GXLOAFNHOXMBBL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.63 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|