C9H9BrFN3O2 — CID 170827097
3-azido-1-(5-bromo-2-fluorophenyl)propane-1,2-diol (PubChem CID 170827097) has the molecular formula C9H9BrFN3O2 and a molecular weight of 290.09 g/mol. Its IUPAC name is 3-azido-1-(5-bromo-2-fluorophenyl)propane-1,2-diol.
| Compound Name | 3-azido-1-(5-bromo-2-fluorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827097 |
| Molecular Formula | C9H9BrFN3O2 |
| Molecular Weight | 290.09 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-azido-1-(5-bromo-2-fluorophenyl)propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C9H9BrFN3O2/c10-5-1-2-7(11)6(3-5)9(16)8(15)4-13-14-12/h1-3,8-9,15-16H,4H2 |
| InChIKey | WIGGXNMRZLQSMH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.09 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|