C9H7F4N3O2 — CID 170826276
3-azido-1-(2,3,5,6-tetrafluorophenyl)propane-1,2-diol (PubChem CID 170826276) has the molecular formula C9H7F4N3O2 and a molecular weight of 265.17 g/mol. Its IUPAC name is 3-azido-1-(2,3,5,6-tetrafluorophenyl)propane-1,2-diol.
| Compound Name | 3-azido-1-(2,3,5,6-tetrafluorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170826276 |
| Molecular Formula | C9H7F4N3O2 |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-azido-1-(2,3,5,6-tetrafluorophenyl)propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H7F4N3O2/c10-3-1-4(11)8(13)6(7(3)12)9(18)5(17)2-15-16-14/h1,5,9,17-18H,2H2 |
| InChIKey | MZSYKERZOWDCEM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|