C10H10FN3O4 — CID 170826281
5-(3-azido-1,2-dihydroxypropyl)-2-fluorobenzoic acid (PubChem CID 170826281) has the molecular formula C10H10FN3O4 and a molecular weight of 255.21 g/mol. Its IUPAC name is 5-(3-azido-1,2-dihydroxypropyl)-2-fluorobenzoic acid.
| Compound Name | 5-(3-azido-1,2-dihydroxypropyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 170826281 |
| Molecular Formula | C10H10FN3O4 |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 5-(3-azido-1,2-dihydroxypropyl)-2-fluorobenzoic acid |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H10FN3O4/c11-7-2-1-5(3-6(7)10(17)18)9(16)8(15)4-13-14-12/h1-3,8-9,15-16H,4H2,(H,17,18) |
| InChIKey | CVFFRJCDBGEEMN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|