C11H14N4O4 — CID 171879916
2-amino-5-(4-azido-1,2-dihydroxybutyl)benzoic acid (PubChem CID 171879916) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-amino-5-(4-azido-1,2-dihydroxybutyl)benzoic acid.
| Compound Name | 2-amino-5-(4-azido-1,2-dihydroxybutyl)benzoic acid |
|---|---|
| PubChem CID | 171879916 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-amino-5-(4-azido-1,2-dihydroxybutyl)benzoic acid |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc(N)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H14N4O4/c12-8-2-1-6(5-7(8)11(18)19)10(17)9(16)3-4-14-15-13/h1-2,5,9-10,16-17H,3-4,12H2,(H,18,19) |
| InChIKey | BKNRCROWWWUUKN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 152.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|