C13H18N4O4 — CID 171880385
ethyl 2-amino-5-(4-azido-1,2-dihydroxybutyl)benzoate (PubChem CID 171880385) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is ethyl 2-amino-5-(4-azido-1,2-dihydroxybutyl)benzoate.
| Compound Name | ethyl 2-amino-5-(4-azido-1,2-dihydroxybutyl)benzoate |
|---|---|
| PubChem CID | 171880385 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | ethyl 2-amino-5-(4-azido-1,2-dihydroxybutyl)benzoate |
| SMILES | CCOC(=O)c1cc(C(O)C(O)CCN=[N+]=[N-])ccc1N |
| InChI | InChI=1S/C13H18N4O4/c1-2-21-13(20)9-7-8(3-4-10(9)14)12(19)11(18)5-6-16-17-15/h3-4,7,11-12,18-19H,2,5-6,14H2,1H3 |
| InChIKey | UJXFMUDIEZABMA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|