C16H16N4O3 — CID 170827062
[2-amino-5-(3-azido-1,2-dihydroxypropyl)phenyl]-phenylmethanone (PubChem CID 170827062) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is [2-amino-5-(3-azido-1,2-dihydroxypropyl)phenyl]-phenylmethanone.
| Compound Name | [2-amino-5-(3-azido-1,2-dihydroxypropyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 170827062 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [2-amino-5-(3-azido-1,2-dihydroxypropyl)phenyl]-phenylmethanone |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ccc(N)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H16N4O3/c17-13-7-6-11(16(23)14(21)9-19-20-18)8-12(13)15(22)10-4-2-1-3-5-10/h1-8,14,16,21,23H,9,17H2 |
| InChIKey | AOHIVEWONWCXNO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|