C19H21NO4S — CID 171876925
S-[4-(4-amino-3-benzoylphenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876925) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is S-[4-(4-amino-3-benzoylphenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(4-amino-3-benzoylphenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876925 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | S-[4-(4-amino-3-benzoylphenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc(N)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H21NO4S/c1-12(21)25-10-9-17(22)19(24)14-7-8-16(20)15(11-14)18(23)13-5-3-2-4-6-13/h2-8,11,17,19,22,24H,9-10,20H2,1H3 |
| InChIKey | LWXNVLKPQGFLDI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|