C20H18O5S — CID 171876930
S-[4-(9,10-dioxophenanthren-3-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876930) has the molecular formula C20H18O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is S-[4-(9,10-dioxophenanthren-3-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(9,10-dioxophenanthren-3-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876930 |
| Molecular Formula | C20H18O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | S-[4-(9,10-dioxophenanthren-3-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc2c(c1)-c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C20H18O5S/c1-11(21)26-9-8-17(22)18(23)12-6-7-15-16(10-12)13-4-2-3-5-14(13)19(24)20(15)25/h2-7,10,17-18,22-23H,8-9H2,1H3 |
| InChIKey | ZEXPMAOZDYFQFA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|