C17H15BrO3 — CID 171893035
2-(4-bromo-1,2-dihydroxybutyl)fluoren-9-one (PubChem CID 171893035) has the molecular formula C17H15BrO3 and a molecular weight of 347.21 g/mol. Its IUPAC name is 2-(4-bromo-1,2-dihydroxybutyl)fluoren-9-one.
| Compound Name | 2-(4-bromo-1,2-dihydroxybutyl)fluoren-9-one |
|---|---|
| PubChem CID | 171893035 |
| Molecular Formula | C17H15BrO3 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-(4-bromo-1,2-dihydroxybutyl)fluoren-9-one |
| SMILES | O=C1c2ccccc2-c2ccc(C(O)C(O)CCBr)cc21 |
| InChI | InChI=1S/C17H15BrO3/c18-8-7-15(19)16(20)10-5-6-12-11-3-1-2-4-13(11)17(21)14(12)9-10/h1-6,9,15-16,19-20H,7-8H2 |
| InChIKey | LLBCNCIMXGBLJQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|