C11H13BrO3 — CID 171891629
3-(4-bromo-1,2-dihydroxybutyl)benzaldehyde (PubChem CID 171891629) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 3-(4-bromo-1,2-dihydroxybutyl)benzaldehyde.
| Compound Name | 3-(4-bromo-1,2-dihydroxybutyl)benzaldehyde |
|---|---|
| PubChem CID | 171891629 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 3-(4-bromo-1,2-dihydroxybutyl)benzaldehyde |
| SMILES | O=Cc1cccc(C(O)C(O)CCBr)c1 |
| InChI | InChI=1S/C11H13BrO3/c12-5-4-10(14)11(15)9-3-1-2-8(6-9)7-13/h1-3,6-7,10-11,14-15H,4-5H2 |
| InChIKey | KWCYEWXTOVQOSN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|