C11H14BrNO3 — CID 171892120
4-bromo-1-[3-(hydroxyiminomethyl)phenyl]butane-1,2-diol (PubChem CID 171892120) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is 4-bromo-1-[3-(hydroxyiminomethyl)phenyl]butane-1,2-diol.
| Compound Name | 4-bromo-1-[3-(hydroxyiminomethyl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171892120 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-bromo-1-[3-(hydroxyiminomethyl)phenyl]butane-1,2-diol |
| SMILES | ON=Cc1cccc(C(O)C(O)CCBr)c1 |
| InChI | InChI=1S/C11H14BrNO3/c12-5-4-10(14)11(15)9-3-1-2-8(6-9)7-13-16/h1-3,6-7,10-11,14-16H,4-5H2 |
| InChIKey | RTPULPVOXKYQBI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|