C10H11BrF2O2 — CID 171891582
4-bromo-1-(2,6-difluorophenyl)butane-1,2-diol (PubChem CID 171891582) has the molecular formula C10H11BrF2O2 and a molecular weight of 281.10 g/mol. Its IUPAC name is 4-bromo-1-(2,6-difluorophenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(2,6-difluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891582 |
| Molecular Formula | C10H11BrF2O2 |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 4-bromo-1-(2,6-difluorophenyl)butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H11BrF2O2/c11-5-4-8(14)10(15)9-6(12)2-1-3-7(9)13/h1-3,8,10,14-15H,4-5H2 |
| InChIKey | SIIFNJOVLZKMHK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|