C11H14BrClO2 — CID 171891540
4-bromo-1-(2-chloro-6-methylphenyl)butane-1,2-diol (PubChem CID 171891540) has the molecular formula C11H14BrClO2 and a molecular weight of 293.59 g/mol. Its IUPAC name is 4-bromo-1-(2-chloro-6-methylphenyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(2-chloro-6-methylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891540 |
| Molecular Formula | C11H14BrClO2 |
| Molecular Weight | 293.59 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 4-bromo-1-(2-chloro-6-methylphenyl)butane-1,2-diol |
| SMILES | Cc1cccc(Cl)c1C(O)C(O)CCBr |
| InChI | InChI=1S/C11H14BrClO2/c1-7-3-2-4-8(13)10(7)11(15)9(14)5-6-12/h2-4,9,11,14-15H,5-6H2,1H3 |
| InChIKey | LVZVFMJWHSNFFN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|