C12H16Cl2O2 — CID 66633917
(1R)-1-(2,6-dichlorophenyl)hexane-1,2-diol (PubChem CID 66633917) has the molecular formula C12H16Cl2O2 and a molecular weight of 263.16 g/mol. Its IUPAC name is (1R)-1-(2,6-dichlorophenyl)hexane-1,2-diol.
| Compound Name | (1R)-1-(2,6-dichlorophenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 66633917 |
| Molecular Formula | C12H16Cl2O2 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | (1R)-1-(2,6-dichlorophenyl)hexane-1,2-diol |
| SMILES | CCCCC(O)[C@H](O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H16Cl2O2/c1-2-3-7-10(15)12(16)11-8(13)5-4-6-9(11)14/h4-6,10,12,15-16H,2-3,7H2,1H3/t10?,12-/m0/s1 |
| InChIKey | GASSOTNCOMXJIO-KFJBMODSSA-N |
| XLogP | 3.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |