C9H9BrCl2O2 — CID 171859547
3-bromo-1-(2,6-dichlorophenyl)propane-1,2-diol (PubChem CID 171859547) has the molecular formula C9H9BrCl2O2 and a molecular weight of 299.98 g/mol. Its IUPAC name is 3-bromo-1-(2,6-dichlorophenyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(2,6-dichlorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171859547 |
| Molecular Formula | C9H9BrCl2O2 |
| Molecular Weight | 299.98 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | 3-bromo-1-(2,6-dichlorophenyl)propane-1,2-diol |
| SMILES | OC(CBr)C(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9BrCl2O2/c10-4-7(13)9(14)8-5(11)2-1-3-6(8)12/h1-3,7,9,13-14H,4H2 |
| InChIKey | QMRAZIDCLHXYHM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.98 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|