C9H11Cl2NO2 — CID 170827623
3-amino-1-(2,6-dichlorophenyl)propane-1,2-diol (PubChem CID 170827623) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 3-amino-1-(2,6-dichlorophenyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(2,6-dichlorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827623 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 3-amino-1-(2,6-dichlorophenyl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H11Cl2NO2/c10-5-2-1-3-6(11)8(5)9(14)7(13)4-12/h1-3,7,9,13-14H,4,12H2 |
| InChIKey | PRJBCTUYONATSK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |