C9H10Cl2O2S — CID 170819441
1-(2,6-dichlorophenyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170819441) has the molecular formula C9H10Cl2O2S and a molecular weight of 253.15 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(2,6-dichlorophenyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819441 |
| Molecular Formula | C9H10Cl2O2S |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-sulfanylpropane-1,2-diol |
| SMILES | OC(CS)C(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H10Cl2O2S/c10-5-2-1-3-6(11)8(5)9(13)7(12)4-14/h1-3,7,9,12-14H,4H2 |
| InChIKey | BUCCYSGSRGSCDE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|