C9H9Cl2O2- — CID 144705772
(1R,2R)-1-(2,6-dichlorophenyl)-2-hydroxypropan-1-olate (PubChem CID 144705772) has the molecular formula C9H9Cl2O2- and a molecular weight of 220.07 g/mol. Its IUPAC name is (1R,2R)-1-(2,6-dichlorophenyl)-2-hydroxypropan-1-olate.
| Compound Name | (1R,2R)-1-(2,6-dichlorophenyl)-2-hydroxypropan-1-olate |
|---|---|
| PubChem CID | 144705772 |
| Molecular Formula | C9H9Cl2O2- |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | (1R,2R)-1-(2,6-dichlorophenyl)-2-hydroxypropan-1-olate |
| SMILES | C[C@@H](O)[C@H]([O-])c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2O2/c1-5(12)9(13)8-6(10)3-2-4-7(8)11/h2-5,9,12H,1H3/q-1/t5-,9+/m1/s1 |
| InChIKey | DINBLFLHSFEZFG-ANLVUFKYSA-N |
| XLogP | 1.78 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |