C9H10Cl2 — CID 14028117
1,3-dichloro-2-propan-2-ylbenzene (PubChem CID 14028117) has the molecular formula C9H10Cl2 and a molecular weight of 189.09 g/mol. Its IUPAC name is 1,3-dichloro-2-propan-2-ylbenzene.
| Compound Name | 1,3-dichloro-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 14028117 |
| Molecular Formula | C9H10Cl2 |
| Molecular Weight | 189.09 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 1,3-dichloro-2-propan-2-ylbenzene |
| SMILES | CC(C)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H10Cl2/c1-6(2)9-7(10)4-3-5-8(9)11/h3-6H,1-2H3 |
| InChIKey | DIEDNWZQIIEMKF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |