About 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene
2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene (PubChem CID 164993906) has the molecular formula C19H23Cl3
and a molecular weight of 357.75 g/mol. Its IUPAC name is 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene |
| PubChem CID | 164993906 |
| Molecular Formula | C19H23Cl3 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene |
| SMILES | CC(C)c1c(Cl)cccc1Cl.Cc1ccc(C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C10H13Cl.C9H10Cl2/c1-7(2)9-5-4-8(3)6-10(9)11;1-6(2)9-7(10)4-3-5-8(9)11/h4-7H,1-3H3;3-6H,1-2H3 |
| InChIKey | HGRWABDLLRQNGQ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene?
The IUPAC name of 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene (CID 164993906) is 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene.
What is the SMILES notation for 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene?
The canonical SMILES for 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene is CC(C)c1c(Cl)cccc1Cl.Cc1ccc(C(C)C)c(Cl)c1.
What is the InChIKey of 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene?
The InChIKey is HGRWABDLLRQNGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl.C9H10Cl2/c1-7(2)9-5-4-8(3)6-10(9)11;1-6(2)9-7(10)4-3-5-8(9)11/h4-7H,1-3H3;3-6H,1-2H3.
What are the key properties of 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene?
2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene has a molecular weight of 357.75 g/mol, XLogP of 7.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-1-propan-2-ylbenzene;1,3-dichloro-2-propan-2-ylbenzene is sourced from PubChem (CID 164993906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).