About 2,2'-Dichlorobiphenyl
2,2'-Dichlorobiphenyl (PubChem CID 25622) has the molecular formula C12H8Cl2
and a molecular weight of 223.09 g/mol. Its IUPAC name is 1-chloro-2-(2-chlorophenyl)benzene.
Molecular Properties
| Compound Name | 2,2'-Dichlorobiphenyl |
| PubChem CID | 25622 |
| Molecular Formula | C12H8Cl2 |
| Molecular Weight | 223.09 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 1-chloro-2-(2-chlorophenyl)benzene |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2Cl)Cl |
| InChI | InChI=1S/C12H8Cl2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
| InChIKey | JAYCNKDKIKZTAF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 161 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.09 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,2'-Dichlorobiphenyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2'-Dichlorobiphenyl?
The IUPAC name of 2,2'-Dichlorobiphenyl (CID 25622) is 1-chloro-2-(2-chlorophenyl)benzene.
What is the SMILES notation for 2,2'-Dichlorobiphenyl?
The canonical SMILES for 2,2'-Dichlorobiphenyl is C1=CC=C(C(=C1)C2=CC=CC=C2Cl)Cl.
What is the InChIKey of 2,2'-Dichlorobiphenyl?
The InChIKey is JAYCNKDKIKZTAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H.
What are the key properties of 2,2'-Dichlorobiphenyl?
2,2'-Dichlorobiphenyl has a molecular weight of 223.09 g/mol, XLogP of 5.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2'-Dichlorobiphenyl is sourced from PubChem (CID 25622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).