About 1-chloronaphthalene
1-chloronaphthalene (PubChem CID 7003) has the molecular formula C10H7Cl
and a molecular weight of 162.62 g/mol. Its IUPAC name is 1-chloronaphthalene.
Molecular Properties
| Compound Name | 1-chloronaphthalene |
| PubChem CID | 7003 |
| Molecular Formula | C10H7Cl |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 1-chloronaphthalene |
| SMILES | Clc1cccc2ccccc12 |
| InChI | InChI=1S/C10H7Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | JTPNRXUCIXHOKM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloronaphthalene?
The IUPAC name of 1-chloronaphthalene (CID 7003) is 1-chloronaphthalene.
What is the SMILES notation for 1-chloronaphthalene?
The canonical SMILES for 1-chloronaphthalene is Clc1cccc2ccccc12.
What is the InChIKey of 1-chloronaphthalene?
The InChIKey is JTPNRXUCIXHOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H.
What are the key properties of 1-chloronaphthalene?
1-chloronaphthalene has a molecular weight of 162.62 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloronaphthalene is sourced from PubChem (CID 7003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).