C10H4Cl4 — CID 29910
1,2,3,4-tetrachloronaphthalene (PubChem CID 29910) has the molecular formula C10H4Cl4 and a molecular weight of 265.95 g/mol. Its IUPAC name is 1,2,3,4-tetrachloronaphthalene.
| Compound Name | 1,2,3,4-tetrachloronaphthalene |
|---|---|
| PubChem CID | 29910 |
| Molecular Formula | C10H4Cl4 |
| Molecular Weight | 265.95 g/mol |
| Exact Mass | 263.91 |
| IUPAC Name | 1,2,3,4-tetrachloronaphthalene |
| SMILES | Clc1c(Cl)c(Cl)c2ccccc2c1Cl |
| InChI | InChI=1S/C10H4Cl4/c11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h1-4H |
| InChIKey | NAQWICRLNQSPPW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.95 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|