C10Cl8 — CID 16692
1,2,3,4,5,6,7,8-octachloronaphthalene (PubChem CID 16692) has the molecular formula C10Cl8 and a molecular weight of 403.73 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octachloronaphthalene.
| Compound Name | 1,2,3,4,5,6,7,8-octachloronaphthalene |
|---|---|
| PubChem CID | 16692 |
| Molecular Formula | C10Cl8 |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 399.75 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octachloronaphthalene |
| SMILES | Clc1c(Cl)c(Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2c1Cl |
| InChI | InChI=1S/C10Cl8/c11-3-1-2(5(13)9(17)7(3)15)6(14)10(18)8(16)4(1)12 |
| InChIKey | RTNLUFLDZOAXIC-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|