C9H11Cl2N — CID 21336280
3,6-dichloro-2-propan-2-ylaniline (PubChem CID 21336280) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is 3,6-dichloro-2-propan-2-ylaniline.
| Compound Name | 3,6-dichloro-2-propan-2-ylaniline |
|---|---|
| PubChem CID | 21336280 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 3,6-dichloro-2-propan-2-ylaniline |
| SMILES | CC(C)c1c(Cl)ccc(Cl)c1N |
| InChI | InChI=1S/C9H11Cl2N/c1-5(2)8-6(10)3-4-7(11)9(8)12/h3-5H,12H2,1-2H3 |
| InChIKey | BEKRDUWQJLYTSZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|