C12H16Cl3N — CID 141053137
3,4,5-trichloro-2,6-di(propan-2-yl)aniline (PubChem CID 141053137) has the molecular formula C12H16Cl3N and a molecular weight of 280.63 g/mol. Its IUPAC name is 3,4,5-trichloro-2,6-di(propan-2-yl)aniline.
| Compound Name | 3,4,5-trichloro-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 141053137 |
| Molecular Formula | C12H16Cl3N |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 3,4,5-trichloro-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1c(N)c(C(C)C)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl3N/c1-5(2)7-9(13)11(15)10(14)8(6(3)4)12(7)16/h5-6H,16H2,1-4H3 |
| InChIKey | MNIJPSGSYFOQMR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|