C8H6Cl5N — CID 14507644
1-(2,3,4,5,6-pentachlorophenyl)ethanamine (PubChem CID 14507644) has the molecular formula C8H6Cl5N and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentachlorophenyl)ethanamine.
| Compound Name | 1-(2,3,4,5,6-pentachlorophenyl)ethanamine |
|---|---|
| PubChem CID | 14507644 |
| Molecular Formula | C8H6Cl5N |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 290.89 |
| IUPAC Name | 1-(2,3,4,5,6-pentachlorophenyl)ethanamine |
| SMILES | CC(N)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl5N/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h2H,14H2,1H3 |
| InChIKey | LPJRFADWHRBNTI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|