C9H9Cl3FN — CID 156531103
3,4,5-trichloro-2-fluoro-6-propan-2-ylaniline (PubChem CID 156531103) has the molecular formula C9H9Cl3FN and a molecular weight of 256.53 g/mol. Its IUPAC name is 3,4,5-trichloro-2-fluoro-6-propan-2-ylaniline.
| Compound Name | 3,4,5-trichloro-2-fluoro-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 156531103 |
| Molecular Formula | C9H9Cl3FN |
| Molecular Weight | 256.53 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 3,4,5-trichloro-2-fluoro-6-propan-2-ylaniline |
| SMILES | CC(C)c1c(N)c(F)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl3FN/c1-3(2)4-5(10)6(11)7(12)8(13)9(4)14/h3H,14H2,1-2H3 |
| InChIKey | KGHCSLBBQTZLNC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|