C10H10Cl3F — CID 167303286
1,2,5-trichloro-3-fluoro-4-methyl-6-propan-2-ylbenzene (PubChem CID 167303286) has the molecular formula C10H10Cl3F and a molecular weight of 255.55 g/mol. Its IUPAC name is 1,2,5-trichloro-3-fluoro-4-methyl-6-propan-2-ylbenzene.
| Compound Name | 1,2,5-trichloro-3-fluoro-4-methyl-6-propan-2-ylbenzene |
|---|---|
| PubChem CID | 167303286 |
| Molecular Formula | C10H10Cl3F |
| Molecular Weight | 255.55 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 1,2,5-trichloro-3-fluoro-4-methyl-6-propan-2-ylbenzene |
| SMILES | Cc1c(F)c(Cl)c(Cl)c(C(C)C)c1Cl |
| InChI | InChI=1S/C10H10Cl3F/c1-4(2)6-7(11)5(3)10(14)9(13)8(6)12/h4H,1-3H3 |
| InChIKey | QYZPWTUETMWWSJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|