C8H6ClF3 — CID 175248816
1-chloro-2,3,6-trifluoro-4,5-dimethylbenzene (PubChem CID 175248816) has the molecular formula C8H6ClF3 and a molecular weight of 194.58 g/mol. Its IUPAC name is 1-chloro-2,3,6-trifluoro-4,5-dimethylbenzene.
| Compound Name | 1-chloro-2,3,6-trifluoro-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 175248816 |
| Molecular Formula | C8H6ClF3 |
| Molecular Weight | 194.58 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 1-chloro-2,3,6-trifluoro-4,5-dimethylbenzene |
| SMILES | Cc1c(C)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C8H6ClF3/c1-3-4(2)7(11)8(12)5(9)6(3)10/h1-2H3 |
| InChIKey | QLWXOMHULZXZSG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|