C6BrCl2F3 — CID 118836073
1-bromo-2,4-dichloro-3,5,6-trifluorobenzene (PubChem CID 118836073) has the molecular formula C6BrCl2F3 and a molecular weight of 279.87 g/mol. Its IUPAC name is 1-bromo-2,4-dichloro-3,5,6-trifluorobenzene.
| Compound Name | 1-bromo-2,4-dichloro-3,5,6-trifluorobenzene |
|---|---|
| PubChem CID | 118836073 |
| Molecular Formula | C6BrCl2F3 |
| Molecular Weight | 279.87 g/mol |
| Exact Mass | 277.85 |
| IUPAC Name | 1-bromo-2,4-dichloro-3,5,6-trifluorobenzene |
| SMILES | Fc1c(F)c(Br)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C6BrCl2F3/c7-1-2(8)5(11)3(9)6(12)4(1)10 |
| InChIKey | PNUQAWDIFNRYSX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|