C6HBr2ClF2 — CID 118819170
1,4-dibromo-3-chloro-2,5-difluorobenzene (PubChem CID 118819170) has the molecular formula C6HBr2ClF2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 1,4-dibromo-3-chloro-2,5-difluorobenzene.
| Compound Name | 1,4-dibromo-3-chloro-2,5-difluorobenzene |
|---|---|
| PubChem CID | 118819170 |
| Molecular Formula | C6HBr2ClF2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 303.81 |
| IUPAC Name | 1,4-dibromo-3-chloro-2,5-difluorobenzene |
| SMILES | Fc1cc(Br)c(F)c(Cl)c1Br |
| InChI | InChI=1S/C6HBr2ClF2/c7-2-1-3(10)4(8)5(9)6(2)11/h1H |
| InChIKey | XMMXOYLGLZDQIN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|