C6H2BrClF2 — CID 2773255
1-bromo-2-chloro-4,5-difluorobenzene (PubChem CID 2773255) has the molecular formula C6H2BrClF2 and a molecular weight of 227.43 g/mol. Its IUPAC name is 1-bromo-2-chloro-4,5-difluorobenzene.
| Compound Name | 1-bromo-2-chloro-4,5-difluorobenzene |
|---|---|
| PubChem CID | 2773255 |
| Molecular Formula | C6H2BrClF2 |
| Molecular Weight | 227.43 g/mol |
| Exact Mass | 225.90 |
| IUPAC Name | 1-bromo-2-chloro-4,5-difluorobenzene |
| SMILES | Fc1cc(Cl)c(Br)cc1F |
| InChI | InChI=1S/C6H2BrClF2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| InChIKey | OKGLKEDYKFGKOW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|