C13H5Br2ClF4 — CID 105399963
1-bromo-4-[bromo-(3,4,5-trifluorophenyl)methyl]-2-chloro-5-fluorobenzene (PubChem CID 105399963) has the molecular formula C13H5Br2ClF4 and a molecular weight of 432.44 g/mol. Its IUPAC name is 1-bromo-4-[bromo-(3,4,5-trifluorophenyl)methyl]-2-chloro-5-fluorobenzene.
| Compound Name | 1-bromo-4-[bromo-(3,4,5-trifluorophenyl)methyl]-2-chloro-5-fluorobenzene |
|---|---|
| PubChem CID | 105399963 |
| Molecular Formula | C13H5Br2ClF4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 429.84 |
| IUPAC Name | 1-bromo-4-[bromo-(3,4,5-trifluorophenyl)methyl]-2-chloro-5-fluorobenzene |
| SMILES | Fc1cc(Br)c(Cl)cc1C(Br)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H5Br2ClF4/c14-7-4-9(17)6(3-8(7)16)12(15)5-1-10(18)13(20)11(19)2-5/h1-4,12H |
| InChIKey | ICXABDCFGUCNJP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|