C16H14Br2ClF — CID 105400116
1-bromo-4-[bromo-(2,4,6-trimethylphenyl)methyl]-2-chloro-5-fluorobenzene (PubChem CID 105400116) has the molecular formula C16H14Br2ClF and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-bromo-4-[bromo-(2,4,6-trimethylphenyl)methyl]-2-chloro-5-fluorobenzene.
| Compound Name | 1-bromo-4-[bromo-(2,4,6-trimethylphenyl)methyl]-2-chloro-5-fluorobenzene |
|---|---|
| PubChem CID | 105400116 |
| Molecular Formula | C16H14Br2ClF |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 417.91 |
| IUPAC Name | 1-bromo-4-[bromo-(2,4,6-trimethylphenyl)methyl]-2-chloro-5-fluorobenzene |
| SMILES | Cc1cc(C)c(C(Br)c2cc(Cl)c(Br)cc2F)c(C)c1 |
| InChI | InChI=1S/C16H14Br2ClF/c1-8-4-9(2)15(10(3)5-8)16(18)11-6-13(19)12(17)7-14(11)20/h4-7,16H,1-3H3 |
| InChIKey | HNTHYFLWQMOCEK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|