C13H6Br2Cl3F — CID 105400009
1-bromo-4-[bromo-(2,4-dichlorophenyl)methyl]-2-chloro-5-fluorobenzene (PubChem CID 105400009) has the molecular formula C13H6Br2Cl3F and a molecular weight of 447.36 g/mol. Its IUPAC name is 1-bromo-4-[bromo-(2,4-dichlorophenyl)methyl]-2-chloro-5-fluorobenzene.
| Compound Name | 1-bromo-4-[bromo-(2,4-dichlorophenyl)methyl]-2-chloro-5-fluorobenzene |
|---|---|
| PubChem CID | 105400009 |
| Molecular Formula | C13H6Br2Cl3F |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 443.79 |
| IUPAC Name | 1-bromo-4-[bromo-(2,4-dichlorophenyl)methyl]-2-chloro-5-fluorobenzene |
| SMILES | Fc1cc(Br)c(Cl)cc1C(Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H6Br2Cl3F/c14-9-5-12(19)8(4-11(9)18)13(15)7-2-1-6(16)3-10(7)17/h1-5,13H |
| InChIKey | KGYRZVXLICAENG-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|