C13H6BrCl2F3 — CID 103304158
1-[bromo-(2,4-dichlorophenyl)methyl]-2,4,5-trifluorobenzene (PubChem CID 103304158) has the molecular formula C13H6BrCl2F3 and a molecular weight of 370.00 g/mol. Its IUPAC name is 1-[bromo-(2,4-dichlorophenyl)methyl]-2,4,5-trifluorobenzene.
| Compound Name | 1-[bromo-(2,4-dichlorophenyl)methyl]-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 103304158 |
| Molecular Formula | C13H6BrCl2F3 |
| Molecular Weight | 370.00 g/mol |
| Exact Mass | 367.90 |
| IUPAC Name | 1-[bromo-(2,4-dichlorophenyl)methyl]-2,4,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Br)c2ccc(Cl)cc2Cl)cc1F |
| InChI | InChI=1S/C13H6BrCl2F3/c14-13(7-2-1-6(15)3-9(7)16)8-4-11(18)12(19)5-10(8)17/h1-5,13H |
| InChIKey | VTZSPONYORPBPL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.00 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|