C14H9BrClF3 — CID 103304482
1-[bromo-(5-chloro-2-methylphenyl)methyl]-2,4,5-trifluorobenzene (PubChem CID 103304482) has the molecular formula C14H9BrClF3 and a molecular weight of 349.58 g/mol. Its IUPAC name is 1-[bromo-(5-chloro-2-methylphenyl)methyl]-2,4,5-trifluorobenzene.
| Compound Name | 1-[bromo-(5-chloro-2-methylphenyl)methyl]-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 103304482 |
| Molecular Formula | C14H9BrClF3 |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 1-[bromo-(5-chloro-2-methylphenyl)methyl]-2,4,5-trifluorobenzene |
| SMILES | Cc1ccc(Cl)cc1C(Br)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H9BrClF3/c1-7-2-3-8(16)4-9(7)14(15)10-5-12(18)13(19)6-11(10)17/h2-6,14H,1H3 |
| InChIKey | RZTFQYKVXYXSBA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|